C12H18O3 — CID 102543604
1-[4-(1,2-dimethoxyethyl)phenyl]ethanol (PubChem CID 102543604) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 1-[4-(1,2-dimethoxyethyl)phenyl]ethanol.
| Compound Name | 1-[4-(1,2-dimethoxyethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 102543604 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 1-[4-(1,2-dimethoxyethyl)phenyl]ethanol |
| SMILES | COCC(OC)c1ccc(C(C)O)cc1 |
| InChI | InChI=1S/C12H18O3/c1-9(13)10-4-6-11(7-5-10)12(15-3)8-14-2/h4-7,9,12-13H,8H2,1-3H3 |
| InChIKey | HZBXRAFNPGZPAW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |