C12H19NO3 — CID 124500392
(1R)-2-amino-1-[4-[(1R)-1,2-dimethoxyethyl]phenyl]ethanol (PubChem CID 124500392) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is (1R)-2-amino-1-[4-[(1R)-1,2-dimethoxyethyl]phenyl]ethanol.
| Compound Name | (1R)-2-amino-1-[4-[(1R)-1,2-dimethoxyethyl]phenyl]ethanol |
|---|---|
| PubChem CID | 124500392 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | (1R)-2-amino-1-[4-[(1R)-1,2-dimethoxyethyl]phenyl]ethanol |
| SMILES | COC[C@H](OC)c1ccc([C@@H](O)CN)cc1 |
| InChI | InChI=1S/C12H19NO3/c1-15-8-12(16-2)10-5-3-9(4-6-10)11(14)7-13/h3-6,11-12,14H,7-8,13H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | URBDUTOIOCDRNK-RYUDHWBXSA-N |
| XLogP | 1.01 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |