C16H20O2 — CID 178156280
benzene;[(1R)-1,2-dimethoxyethyl]benzene (PubChem CID 178156280) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is benzene;[(1R)-1,2-dimethoxyethyl]benzene.
| Compound Name | benzene;[(1R)-1,2-dimethoxyethyl]benzene |
|---|---|
| PubChem CID | 178156280 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | benzene;[(1R)-1,2-dimethoxyethyl]benzene |
| SMILES | COC[C@H](OC)c1ccccc1.c1ccccc1 |
| InChI | InChI=1S/C10H14O2.C6H6/c1-11-8-10(12-2)9-6-4-3-5-7-9;1-2-4-6-5-3-1/h3-7,10H,8H2,1-2H3;1-6H/t10-;/m0./s1 |
| InChIKey | JORWIEMOYQPMDT-PPHPATTJSA-N |
| XLogP | 3.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |