C13H20O3 — CID 117322250
1-[4-(1,2-dimethoxyethyl)phenyl]propan-2-ol (PubChem CID 117322250) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is 1-[4-(1,2-dimethoxyethyl)phenyl]propan-2-ol.
| Compound Name | 1-[4-(1,2-dimethoxyethyl)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 117322250 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 1-[4-(1,2-dimethoxyethyl)phenyl]propan-2-ol |
| SMILES | COCC(OC)c1ccc(CC(C)O)cc1 |
| InChI | InChI=1S/C13H20O3/c1-10(14)8-11-4-6-12(7-5-11)13(16-3)9-15-2/h4-7,10,13-14H,8-9H2,1-3H3 |
| InChIKey | HUFGNZQUSMTCFC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |