C16H22O4 — CID 117446147
1-[4-(1,2-dimethoxyethyl)phenyl]cyclopentane-1-carboxylic acid (PubChem CID 117446147) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is 1-[4-(1,2-dimethoxyethyl)phenyl]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[4-(1,2-dimethoxyethyl)phenyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 117446147 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 1-[4-(1,2-dimethoxyethyl)phenyl]cyclopentane-1-carboxylic acid |
| SMILES | COCC(OC)c1ccc(C2(C(=O)O)CCCC2)cc1 |
| InChI | InChI=1S/C16H22O4/c1-19-11-14(20-2)12-5-7-13(8-6-12)16(15(17)18)9-3-4-10-16/h5-8,14H,3-4,9-11H2,1-2H3,(H,17,18) |
| InChIKey | PLLLHUNERJHNHW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |