C12H18O4 — CID 6424872
4-(1,2-dimethoxyethyl)-1,2-dimethoxybenzene (PubChem CID 6424872) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is 4-(1,2-dimethoxyethyl)-1,2-dimethoxybenzene.
| Compound Name | 4-(1,2-dimethoxyethyl)-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 6424872 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 4-(1,2-dimethoxyethyl)-1,2-dimethoxybenzene |
| SMILES | COCC(OC)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C12H18O4/c1-13-8-12(16-4)9-5-6-10(14-2)11(7-9)15-3/h5-7,12H,8H2,1-4H3 |
| InChIKey | FBZUMNXNTSNNCG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |