C21H28O7 — CID 162867963
2-[(R)-(3,4-dimethoxyphenyl)-methoxymethyl]-1,5-dimethoxy-3-(2-methoxyethoxy)benzene (PubChem CID 162867963) has the molecular formula C21H28O7 and a molecular weight of 392.45 g/mol. Its IUPAC name is 2-[(R)-(3,4-dimethoxyphenyl)-methoxymethyl]-1,5-dimethoxy-3-(2-methoxyethoxy)benzene.
| Compound Name | 2-[(R)-(3,4-dimethoxyphenyl)-methoxymethyl]-1,5-dimethoxy-3-(2-methoxyethoxy)benzene |
|---|---|
| PubChem CID | 162867963 |
| Molecular Formula | C21H28O7 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 2-[(R)-(3,4-dimethoxyphenyl)-methoxymethyl]-1,5-dimethoxy-3-(2-methoxyethoxy)benzene |
| SMILES | COCCOc1cc(OC)cc(OC)c1[C@H](OC)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C21H28O7/c1-22-9-10-28-19-13-15(23-2)12-18(26-5)20(19)21(27-6)14-7-8-16(24-3)17(11-14)25-4/h7-8,11-13,21H,9-10H2,1-6H3/t21-/m1/s1 |
| InChIKey | WFQUJVPQIYCOMB-OAQYLSRUSA-N |
| XLogP | 3.48 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|