C19H26O7 — CID 54271001
1,2,3,5-tetramethoxybenzene;1,2,4-trimethoxybenzene (PubChem CID 54271001) has the molecular formula C19H26O7 and a molecular weight of 366.41 g/mol. Its IUPAC name is 1,2,3,5-tetramethoxybenzene;1,2,4-trimethoxybenzene.
| Compound Name | 1,2,3,5-tetramethoxybenzene;1,2,4-trimethoxybenzene |
|---|---|
| PubChem CID | 54271001 |
| Molecular Formula | C19H26O7 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 1,2,3,5-tetramethoxybenzene;1,2,4-trimethoxybenzene |
| SMILES | COc1cc(OC)c(OC)c(OC)c1.COc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C10H14O4.C9H12O3/c1-11-7-5-8(12-2)10(14-4)9(6-7)13-3;1-10-7-4-5-8(11-2)9(6-7)12-3/h5-6H,1-4H3;4-6H,1-3H3 |
| InChIKey | RKCTWABDVAZIEW-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |