About tris(3,4-dimethoxyphenyl) borate
tris(3,4-dimethoxyphenyl) borate (PubChem CID 67306182) has the molecular formula C24H27BO9
and a molecular weight of 470.28 g/mol. Its IUPAC name is tris(3,4-dimethoxyphenyl) borate.
Molecular Properties
| Compound Name | tris(3,4-dimethoxyphenyl) borate |
| PubChem CID | 67306182 |
| Molecular Formula | C24H27BO9 |
| Molecular Weight | 470.28 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | tris(3,4-dimethoxyphenyl) borate |
| SMILES | COc1ccc(OB(Oc2ccc(OC)c(OC)c2)Oc2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C24H27BO9/c1-26-19-10-7-16(13-22(19)29-4)32-25(33-17-8-11-20(27-2)23(14-17)30-5)34-18-9-12-21(28-3)24(15-18)31-6/h7-15H,1-6H3 |
| InChIKey | LEFCMVWCSYYDGW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.28 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tris(3,4-dimethoxyphenyl) borate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(3,4-dimethoxyphenyl) borate?
The IUPAC name of tris(3,4-dimethoxyphenyl) borate (CID 67306182) is tris(3,4-dimethoxyphenyl) borate.
What is the SMILES notation for tris(3,4-dimethoxyphenyl) borate?
The canonical SMILES for tris(3,4-dimethoxyphenyl) borate is COc1ccc(OB(Oc2ccc(OC)c(OC)c2)Oc2ccc(OC)c(OC)c2)cc1OC.
What is the InChIKey of tris(3,4-dimethoxyphenyl) borate?
The InChIKey is LEFCMVWCSYYDGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27BO9/c1-26-19-10-7-16(13-22(19)29-4)32-25(33-17-8-11-20(27-2)23(14-17)30-5)34-18-9-12-21(28-3)24(15-18)31-6/h7-15H,1-6H3.
What are the key properties of tris(3,4-dimethoxyphenyl) borate?
tris(3,4-dimethoxyphenyl) borate has a molecular weight of 470.28 g/mol, XLogP of 4.26, 12 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for tris(3,4-dimethoxyphenyl) borate is sourced from PubChem (CID 67306182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).