C16H18O4 — CID 123959246
1,2-dimethoxy-4-(5-methoxy-2-methylphenoxy)benzene (PubChem CID 123959246) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is 1,2-dimethoxy-4-(5-methoxy-2-methylphenoxy)benzene.
| Compound Name | 1,2-dimethoxy-4-(5-methoxy-2-methylphenoxy)benzene |
|---|---|
| PubChem CID | 123959246 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 1,2-dimethoxy-4-(5-methoxy-2-methylphenoxy)benzene |
| SMILES | COc1ccc(C)c(Oc2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C16H18O4/c1-11-5-6-12(17-2)9-15(11)20-13-7-8-14(18-3)16(10-13)19-4/h5-10H,1-4H3 |
| InChIKey | HBJNVVOOFGBADL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |