C23H24O2 — CID 160687040
1,4-bis(2,5-dimethylphenoxy)-2-methylbenzene (PubChem CID 160687040) has the molecular formula C23H24O2 and a molecular weight of 332.44 g/mol. Its IUPAC name is 1,4-bis(2,5-dimethylphenoxy)-2-methylbenzene.
| Compound Name | 1,4-bis(2,5-dimethylphenoxy)-2-methylbenzene |
|---|---|
| PubChem CID | 160687040 |
| Molecular Formula | C23H24O2 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 1,4-bis(2,5-dimethylphenoxy)-2-methylbenzene |
| SMILES | Cc1ccc(C)c(Oc2ccc(Oc3cc(C)ccc3C)c(C)c2)c1 |
| InChI | InChI=1S/C23H24O2/c1-15-6-8-17(3)22(12-15)24-20-10-11-21(19(5)14-20)25-23-13-16(2)7-9-18(23)4/h6-14H,1-5H3 |
| InChIKey | ROXBGSSROYZDAG-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |