C16H16O2 — CID 91264614
carbon monoxide;2,4-dimethyl-1-(4-methylphenoxy)benzene (PubChem CID 91264614) has the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. Its IUPAC name is carbon monoxide;2,4-dimethyl-1-(4-methylphenoxy)benzene.
| Compound Name | carbon monoxide;2,4-dimethyl-1-(4-methylphenoxy)benzene |
|---|---|
| PubChem CID | 91264614 |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | carbon monoxide;2,4-dimethyl-1-(4-methylphenoxy)benzene |
| SMILES | Cc1ccc(Oc2ccc(C)cc2C)cc1.[C-]#[O+] |
| InChI | InChI=1S/C15H16O.CO/c1-11-4-7-14(8-5-11)16-15-9-6-12(2)10-13(15)3;1-2/h4-10H,1-3H3; |
| InChIKey | UWZXKHUONHPFHI-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 29.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|