C9H12O — CID 169444379
1-methoxy-2,4-dimethyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene (PubChem CID 169444379) has the molecular formula C9H12O and a molecular weight of 142.15 g/mol. Its IUPAC name is 1-methoxy-2,4-dimethyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene.
| Compound Name | 1-methoxy-2,4-dimethyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene |
|---|---|
| PubChem CID | 169444379 |
| Molecular Formula | C9H12O |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 1-methoxy-2,4-dimethyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene |
| SMILES | CO[13c]1[13cH][13cH][13c](C)[13cH][13c]1C |
| InChI | InChI=1S/C9H12O/c1-7-4-5-9(10-3)8(2)6-7/h4-6H,1-3H3/i4+1,5+1,6+1,7+1,8+1,9+1 |
| InChIKey | UJCFZCTTZWHRNL-VFESMUGCSA-N |
| XLogP | 2.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |