C19H24O3 — CID 2284068
1-[3-(2,4-dimethylphenoxy)propoxy]-2-methoxy-4-methylbenzene (PubChem CID 2284068) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is 1-[3-(2,4-dimethylphenoxy)propoxy]-2-methoxy-4-methylbenzene.
| Compound Name | 1-[3-(2,4-dimethylphenoxy)propoxy]-2-methoxy-4-methylbenzene |
|---|---|
| PubChem CID | 2284068 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 1-[3-(2,4-dimethylphenoxy)propoxy]-2-methoxy-4-methylbenzene |
| SMILES | COc1cc(C)ccc1OCCCOc1ccc(C)cc1C |
| InChI | InChI=1S/C19H24O3/c1-14-6-8-17(16(3)12-14)21-10-5-11-22-18-9-7-15(2)13-19(18)20-4/h6-9,12-13H,5,10-11H2,1-4H3 |
| InChIKey | MRESOJCMPLNORV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|