C11H17NO — CID 14025831
3-(2,4-dimethylphenoxy)propan-1-amine (PubChem CID 14025831) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 3-(2,4-dimethylphenoxy)propan-1-amine.
| Compound Name | 3-(2,4-dimethylphenoxy)propan-1-amine |
|---|---|
| PubChem CID | 14025831 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 3-(2,4-dimethylphenoxy)propan-1-amine |
| SMILES | Cc1ccc(OCCCN)c(C)c1 |
| InChI | InChI=1S/C11H17NO/c1-9-4-5-11(10(2)8-9)13-7-3-6-12/h4-5,8H,3,6-7,12H2,1-2H3 |
| InChIKey | IENJSIDXLXEFPK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|