C13H21NO — CID 29015412
3-(2,4-dimethylphenoxy)-N-ethylpropan-1-amine (PubChem CID 29015412) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 3-(2,4-dimethylphenoxy)-N-ethylpropan-1-amine.
| Compound Name | 3-(2,4-dimethylphenoxy)-N-ethylpropan-1-amine |
|---|---|
| PubChem CID | 29015412 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 3-(2,4-dimethylphenoxy)-N-ethylpropan-1-amine |
| SMILES | CCNCCCOc1ccc(C)cc1C |
| InChI | InChI=1S/C13H21NO/c1-4-14-8-5-9-15-13-7-6-11(2)10-12(13)3/h6-7,10,14H,4-5,8-9H2,1-3H3 |
| InChIKey | KIHCRVSBAMOFDF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|