C13H20O3 — CID 64764967
1-[2-(2-methoxyethoxy)ethoxy]-2,4-dimethylbenzene (PubChem CID 64764967) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is 1-[2-(2-methoxyethoxy)ethoxy]-2,4-dimethylbenzene.
| Compound Name | 1-[2-(2-methoxyethoxy)ethoxy]-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 64764967 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 1-[2-(2-methoxyethoxy)ethoxy]-2,4-dimethylbenzene |
| SMILES | COCCOCCOc1ccc(C)cc1C |
| InChI | InChI=1S/C13H20O3/c1-11-4-5-13(12(2)10-11)16-9-8-15-7-6-14-3/h4-5,10H,6-9H2,1-3H3 |
| InChIKey | XYJFLGACFJJCHH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|