C24H28O3 — CID 126699664
1-[4-[2-(2-methoxyethoxy)ethoxy]-3-methylphenyl]-3,7-dimethylnaphthalene (PubChem CID 126699664) has the molecular formula C24H28O3 and a molecular weight of 364.49 g/mol. Its IUPAC name is 1-[4-[2-(2-methoxyethoxy)ethoxy]-3-methylphenyl]-3,7-dimethylnaphthalene.
| Compound Name | 1-[4-[2-(2-methoxyethoxy)ethoxy]-3-methylphenyl]-3,7-dimethylnaphthalene |
|---|---|
| PubChem CID | 126699664 |
| Molecular Formula | C24H28O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 1-[4-[2-(2-methoxyethoxy)ethoxy]-3-methylphenyl]-3,7-dimethylnaphthalene |
| SMILES | COCCOCCOc1ccc(-c2cc(C)cc3ccc(C)cc23)cc1C |
| InChI | InChI=1S/C24H28O3/c1-17-5-6-20-13-18(2)15-23(22(20)14-17)21-7-8-24(19(3)16-21)27-12-11-26-10-9-25-4/h5-8,13-16H,9-12H2,1-4H3 |
| InChIKey | PYIPWPMEGGFQHX-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|