C27H38O8 — CID 157385446
[5-(2,5-dimethylphenyl)-2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]phenyl]methyl formate (PubChem CID 157385446) has the molecular formula C27H38O8 and a molecular weight of 490.59 g/mol. Its IUPAC name is [5-(2,5-dimethylphenyl)-2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]phenyl]methyl formate.
| Compound Name | [5-(2,5-dimethylphenyl)-2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]phenyl]methyl formate |
|---|---|
| PubChem CID | 157385446 |
| Molecular Formula | C27H38O8 |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | [5-(2,5-dimethylphenyl)-2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]phenyl]methyl formate |
| SMILES | COCCOCCOCCOCCOCCOc1ccc(-c2cc(C)ccc2C)cc1COC=O |
| InChI | InChI=1S/C27H38O8/c1-22-4-5-23(2)26(18-22)24-6-7-27(25(19-24)20-34-21-28)35-17-16-33-15-14-32-13-12-31-11-10-30-9-8-29-3/h4-7,18-19,21H,8-17,20H2,1-3H3 |
| InChIKey | NHAUPJBWUSWHKW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|