C46H60NO6+ — CID 126699689
triethyl-[[2-[2-(2-methoxyethoxy)ethoxy]-5-[10-[4-[2-(2-methoxyethoxy)ethoxy]-3-methylphenyl]-2,6-dimethylanthracen-9-yl]phenyl]methyl]azanium (PubChem CID 126699689) has the molecular formula C46H60NO6+ and a molecular weight of 722.99 g/mol. Its IUPAC name is triethyl-[[2-[2-(2-methoxyethoxy)ethoxy]-5-[10-[4-[2-(2-methoxyethoxy)ethoxy]-3-methylphenyl]-2,6-dimethylanthracen-9-yl]phenyl]methyl]azanium.
| Compound Name | triethyl-[[2-[2-(2-methoxyethoxy)ethoxy]-5-[10-[4-[2-(2-methoxyethoxy)ethoxy]-3-methylphenyl]-2,6-dimethylanthracen-9-yl]phenyl]methyl]azanium |
|---|---|
| PubChem CID | 126699689 |
| Molecular Formula | C46H60NO6+ |
| Molecular Weight | 722.99 g/mol |
| Exact Mass | 722.44 |
| IUPAC Name | triethyl-[[2-[2-(2-methoxyethoxy)ethoxy]-5-[10-[4-[2-(2-methoxyethoxy)ethoxy]-3-methylphenyl]-2,6-dimethylanthracen-9-yl]phenyl]methyl]azanium |
| SMILES | CC[N+](CC)(CC)Cc1cc(-c2c3ccc(C)cc3c(-c3ccc(OCCOCCOC)c(C)c3)c3ccc(C)cc23)ccc1OCCOCCOC |
| InChI | InChI=1S/C46H60NO6/c1-9-47(10-2,11-3)32-38-31-37(15-19-44(38)53-27-25-51-23-21-49-8)46-40-17-13-33(4)28-41(40)45(39-16-12-34(5)29-42(39)46)36-14-18-43(35(6)30-36)52-26-24-50-22-20-48-7/h12-19,28-31H,9-11,20-27,32H2,1-8H3/q+1 |
| InChIKey | XNPOSKGBHQKNJZ-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.99 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|