C44H58N3O6+ — CID 126699685
triethyl-[[2-[2-(2-hydroxyethoxy)ethoxymethyl]-5-[6-[4-[2-(2-methoxyethoxy)ethoxy]-3-methylphenyl]-3,8-dimethyl-1,10-phenanthrolin-5-yl]phenyl]methyl]azanium (PubChem CID 126699685) has the molecular formula C44H58N3O6+ and a molecular weight of 724.96 g/mol. Its IUPAC name is triethyl-[[2-[2-(2-hydroxyethoxy)ethoxymethyl]-5-[6-[4-[2-(2-methoxyethoxy)ethoxy]-3-methylphenyl]-3,8-dimethyl-1,10-phenanthrolin-5-yl]phenyl]methyl]azanium.
| Compound Name | triethyl-[[2-[2-(2-hydroxyethoxy)ethoxymethyl]-5-[6-[4-[2-(2-methoxyethoxy)ethoxy]-3-methylphenyl]-3,8-dimethyl-1,10-phenanthrolin-5-yl]phenyl]methyl]azanium |
|---|---|
| PubChem CID | 126699685 |
| Molecular Formula | C44H58N3O6+ |
| Molecular Weight | 724.96 g/mol |
| Exact Mass | 724.43 |
| IUPAC Name | triethyl-[[2-[2-(2-hydroxyethoxy)ethoxymethyl]-5-[6-[4-[2-(2-methoxyethoxy)ethoxy]-3-methylphenyl]-3,8-dimethyl-1,10-phenanthrolin-5-yl]phenyl]methyl]azanium |
| SMILES | CC[N+](CC)(CC)Cc1cc(-c2c(-c3ccc(OCCOCCOC)c(C)c3)c3cc(C)cnc3c3ncc(C)cc23)ccc1COCCOCCO |
| InChI | InChI=1S/C44H58N3O6/c1-8-47(9-2,10-3)29-37-26-35(11-12-36(37)30-52-20-19-50-16-15-48)42-39-24-32(5)28-46-44(39)43-38(23-31(4)27-45-43)41(42)34-13-14-40(33(6)25-34)53-22-21-51-18-17-49-7/h11-14,23-28,48H,8-10,15-22,29-30H2,1-7H3/q+1 |
| InChIKey | PKHDMVYNPZKSMJ-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.96 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|