C17H22O5 — CID 58864087
2-[2-[5-(2-methoxyethoxy)naphthalen-1-yl]oxyethoxy]ethanol (PubChem CID 58864087) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is 2-[2-[5-(2-methoxyethoxy)naphthalen-1-yl]oxyethoxy]ethanol.
| Compound Name | 2-[2-[5-(2-methoxyethoxy)naphthalen-1-yl]oxyethoxy]ethanol |
|---|---|
| PubChem CID | 58864087 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 2-[2-[5-(2-methoxyethoxy)naphthalen-1-yl]oxyethoxy]ethanol |
| SMILES | COCCOc1cccc2c(OCCOCCO)cccc12 |
| InChI | InChI=1S/C17H22O5/c1-19-10-12-21-16-6-2-5-15-14(16)4-3-7-17(15)22-13-11-20-9-8-18/h2-7,18H,8-13H2,1H3 |
| InChIKey | VHIUQVALISQSLJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|