C22H38O10 — CID 86247130
[4-(hydroxymethyl)-2,5-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]methanol (PubChem CID 86247130) has the molecular formula C22H38O10 and a molecular weight of 462.54 g/mol. Its IUPAC name is [4-(hydroxymethyl)-2,5-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]methanol.
| Compound Name | [4-(hydroxymethyl)-2,5-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]methanol |
|---|---|
| PubChem CID | 86247130 |
| Molecular Formula | C22H38O10 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | [4-(hydroxymethyl)-2,5-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]methanol |
| SMILES | COCCOCCOCCOc1cc(CO)c(OCCOCCOCCOC)cc1CO |
| InChI | InChI=1S/C22H38O10/c1-25-3-5-27-7-9-29-11-13-31-21-15-20(18-24)22(16-19(21)17-23)32-14-12-30-10-8-28-6-4-26-2/h15-16,23-24H,3-14,17-18H2,1-2H3 |
| InChIKey | FCSPNRRABLSUDV-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|