C20H32I2O8 — CID 67250875
1,4-diiodo-2,5-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]benzene (PubChem CID 67250875) has the molecular formula C20H32I2O8 and a molecular weight of 654.28 g/mol. Its IUPAC name is 1,4-diiodo-2,5-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]benzene.
| Compound Name | 1,4-diiodo-2,5-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]benzene |
|---|---|
| PubChem CID | 67250875 |
| Molecular Formula | C20H32I2O8 |
| Molecular Weight | 654.28 g/mol |
| Exact Mass | 654.02 |
| IUPAC Name | 1,4-diiodo-2,5-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]benzene |
| SMILES | COCCOCCOCCOc1cc(I)c(OCCOCCOCCOC)cc1I |
| InChI | InChI=1S/C20H32I2O8/c1-23-3-5-25-7-9-27-11-13-29-19-15-18(22)20(16-17(19)21)30-14-12-28-10-8-26-6-4-24-2/h15-16H,3-14H2,1-2H3 |
| InChIKey | KUKZYKPGRDCALU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|