C15H22Br2O5 — CID 171472574
1,5-dibromo-2-ethoxy-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]benzene (PubChem CID 171472574) has the molecular formula C15H22Br2O5 and a molecular weight of 442.14 g/mol. Its IUPAC name is 1,5-dibromo-2-ethoxy-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]benzene.
| Compound Name | 1,5-dibromo-2-ethoxy-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]benzene |
|---|---|
| PubChem CID | 171472574 |
| Molecular Formula | C15H22Br2O5 |
| Molecular Weight | 442.14 g/mol |
| Exact Mass | 439.98 |
| IUPAC Name | 1,5-dibromo-2-ethoxy-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]benzene |
| SMILES | CCOc1cc(OCCOCCOCCOC)c(Br)cc1Br |
| InChI | InChI=1S/C15H22Br2O5/c1-3-21-14-11-15(13(17)10-12(14)16)22-9-8-20-7-6-19-5-4-18-2/h10-11H,3-9H2,1-2H3 |
| InChIKey | GOEHNZAWDZENRP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.14 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|