C14H17BrO4 — CID 89473205
1-bromo-4-ethynyl-2,5-bis(2-methoxyethoxy)benzene (PubChem CID 89473205) has the molecular formula C14H17BrO4 and a molecular weight of 329.19 g/mol. Its IUPAC name is 1-bromo-4-ethynyl-2,5-bis(2-methoxyethoxy)benzene.
| Compound Name | 1-bromo-4-ethynyl-2,5-bis(2-methoxyethoxy)benzene |
|---|---|
| PubChem CID | 89473205 |
| Molecular Formula | C14H17BrO4 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 1-bromo-4-ethynyl-2,5-bis(2-methoxyethoxy)benzene |
| SMILES | C#Cc1cc(OCCOC)c(Br)cc1OCCOC |
| InChI | InChI=1S/C14H17BrO4/c1-4-11-9-14(19-8-6-17-3)12(15)10-13(11)18-7-5-16-2/h1,9-10H,5-8H2,2-3H3 |
| InChIKey | ZTSNQYXNFOATET-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|