C10H11Br3O — CID 101293487
1,2,4-tribromo-5-butoxybenzene (PubChem CID 101293487) has the molecular formula C10H11Br3O and a molecular weight of 386.91 g/mol. Its IUPAC name is 1,2,4-tribromo-5-butoxybenzene.
| Compound Name | 1,2,4-tribromo-5-butoxybenzene |
|---|---|
| PubChem CID | 101293487 |
| Molecular Formula | C10H11Br3O |
| Molecular Weight | 386.91 g/mol |
| Exact Mass | 383.84 |
| IUPAC Name | 1,2,4-tribromo-5-butoxybenzene |
| SMILES | CCCCOc1cc(Br)c(Br)cc1Br |
| InChI | InChI=1S/C10H11Br3O/c1-2-3-4-14-10-6-8(12)7(11)5-9(10)13/h5-6H,2-4H2,1H3 |
| InChIKey | JAQWCLMWAVIUOM-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.91 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|