C20H30BrNO2 — CID 640270
2-(4-bromo-2,5-dihexoxyphenyl)acetonitrile (PubChem CID 640270) has the molecular formula C20H30BrNO2 and a molecular weight of 396.37 g/mol. Its IUPAC name is 2-(4-bromo-2,5-dihexoxyphenyl)acetonitrile.
| Compound Name | 2-(4-bromo-2,5-dihexoxyphenyl)acetonitrile |
|---|---|
| PubChem CID | 640270 |
| Molecular Formula | C20H30BrNO2 |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 2-(4-bromo-2,5-dihexoxyphenyl)acetonitrile |
| SMILES | CCCCCCOc1cc(CC#N)c(OCCCCCC)cc1Br |
| InChI | InChI=1S/C20H30BrNO2/c1-3-5-7-9-13-23-19-16-18(21)20(15-17(19)11-12-22)24-14-10-8-6-4-2/h15-16H,3-11,13-14H2,1-2H3 |
| InChIKey | RQESUENQBJYKGI-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|