C31H41Br2NO2 — CID 69078699
3-(4-bromo-2,5-dioctoxyphenyl)-2-(4-bromophenyl)prop-2-enenitrile (PubChem CID 69078699) has the molecular formula C31H41Br2NO2 and a molecular weight of 619.48 g/mol. Its IUPAC name is 3-(4-bromo-2,5-dioctoxyphenyl)-2-(4-bromophenyl)prop-2-enenitrile.
| Compound Name | 3-(4-bromo-2,5-dioctoxyphenyl)-2-(4-bromophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 69078699 |
| Molecular Formula | C31H41Br2NO2 |
| Molecular Weight | 619.48 g/mol |
| Exact Mass | 617.15 |
| IUPAC Name | 3-(4-bromo-2,5-dioctoxyphenyl)-2-(4-bromophenyl)prop-2-enenitrile |
| SMILES | CCCCCCCCOc1cc(C=C(C#N)c2ccc(Br)cc2)c(OCCCCCCCC)cc1Br |
| InChI | InChI=1S/C31H41Br2NO2/c1-3-5-7-9-11-13-19-35-30-23-29(33)31(36-20-14-12-10-8-6-4-2)22-26(30)21-27(24-34)25-15-17-28(32)18-16-25/h15-18,21-23H,3-14,19-20H2,1-2H3 |
| InChIKey | BMMYVQFNZXIQLY-UHFFFAOYSA-N |
| XLogP | 10.75 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.48 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|