C19H18ClNO — CID 2225803
(Z)-3-(2-butoxy-5-chlorophenyl)-2-phenylprop-2-enenitrile (PubChem CID 2225803) has the molecular formula C19H18ClNO and a molecular weight of 311.81 g/mol. Its IUPAC name is (Z)-3-(2-butoxy-5-chlorophenyl)-2-phenylprop-2-enenitrile.
| Compound Name | (Z)-3-(2-butoxy-5-chlorophenyl)-2-phenylprop-2-enenitrile |
|---|---|
| PubChem CID | 2225803 |
| Molecular Formula | C19H18ClNO |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | (Z)-3-(2-butoxy-5-chlorophenyl)-2-phenylprop-2-enenitrile |
| SMILES | CCCCOc1ccc(Cl)cc1/C=C(\C#N)c1ccccc1 |
| InChI | InChI=1S/C19H18ClNO/c1-2-3-11-22-19-10-9-18(20)13-16(19)12-17(14-21)15-7-5-4-6-8-15/h4-10,12-13H,2-3,11H2,1H3/b17-12+ |
| InChIKey | DSKVDWJAOQGKES-SFQUDFHCSA-N |
| XLogP | 5.58 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|