C25H19Cl2NO3 — CID 39115048
[3-[(E)-2-cyano-2-phenylethenyl]phenyl] 4-(2,4-dichlorophenoxy)butanoate (PubChem CID 39115048) has the molecular formula C25H19Cl2NO3 and a molecular weight of 452.34 g/mol. Its IUPAC name is [3-[(E)-2-cyano-2-phenylethenyl]phenyl] 4-(2,4-dichlorophenoxy)butanoate.
| Compound Name | [3-[(E)-2-cyano-2-phenylethenyl]phenyl] 4-(2,4-dichlorophenoxy)butanoate |
|---|---|
| PubChem CID | 39115048 |
| Molecular Formula | C25H19Cl2NO3 |
| Molecular Weight | 452.34 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | [3-[(E)-2-cyano-2-phenylethenyl]phenyl] 4-(2,4-dichlorophenoxy)butanoate |
| SMILES | N#C/C(=C/c1cccc(OC(=O)CCCOc2ccc(Cl)cc2Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C25H19Cl2NO3/c26-21-11-12-24(23(27)16-21)30-13-5-10-25(29)31-22-9-4-6-18(15-22)14-20(17-28)19-7-2-1-3-8-19/h1-4,6-9,11-12,14-16H,5,10,13H2/b20-14- |
| InChIKey | ZOROHSSMHULSJR-ZHZULCJRSA-N |
| XLogP | 6.82 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.34 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|