C27H19ClN2O4 — CID 39115483
[3-[(E)-2-(4-chlorophenyl)-2-cyanoethenyl]phenyl] 4-(1,3-dioxoisoindol-2-yl)butanoate (PubChem CID 39115483) has the molecular formula C27H19ClN2O4 and a molecular weight of 470.91 g/mol. Its IUPAC name is [3-[(E)-2-(4-chlorophenyl)-2-cyanoethenyl]phenyl] 4-(1,3-dioxoisoindol-2-yl)butanoate.
| Compound Name | [3-[(E)-2-(4-chlorophenyl)-2-cyanoethenyl]phenyl] 4-(1,3-dioxoisoindol-2-yl)butanoate |
|---|---|
| PubChem CID | 39115483 |
| Molecular Formula | C27H19ClN2O4 |
| Molecular Weight | 470.91 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | [3-[(E)-2-(4-chlorophenyl)-2-cyanoethenyl]phenyl] 4-(1,3-dioxoisoindol-2-yl)butanoate |
| SMILES | N#C/C(=C/c1cccc(OC(=O)CCCN2C(=O)c3ccccc3C2=O)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H19ClN2O4/c28-21-12-10-19(11-13-21)20(17-29)15-18-5-3-6-22(16-18)34-25(31)9-4-14-30-26(32)23-7-1-2-8-24(23)27(30)33/h1-3,5-8,10-13,15-16H,4,9,14H2/b20-15- |
| InChIKey | UCKITIFCFMGQQQ-HKWRFOASSA-N |
| XLogP | 5.39 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.91 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|