C28H21FN2O5 — CID 39114223
[4-[(E)-2-cyano-2-(2-fluorophenyl)ethenyl]-2-methoxyphenyl] 4-(1,3-dioxoisoindol-2-yl)butanoate (PubChem CID 39114223) has the molecular formula C28H21FN2O5 and a molecular weight of 484.48 g/mol. Its IUPAC name is [4-[(E)-2-cyano-2-(2-fluorophenyl)ethenyl]-2-methoxyphenyl] 4-(1,3-dioxoisoindol-2-yl)butanoate.
| Compound Name | [4-[(E)-2-cyano-2-(2-fluorophenyl)ethenyl]-2-methoxyphenyl] 4-(1,3-dioxoisoindol-2-yl)butanoate |
|---|---|
| PubChem CID | 39114223 |
| Molecular Formula | C28H21FN2O5 |
| Molecular Weight | 484.48 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | [4-[(E)-2-cyano-2-(2-fluorophenyl)ethenyl]-2-methoxyphenyl] 4-(1,3-dioxoisoindol-2-yl)butanoate |
| SMILES | COc1cc(/C=C(/C#N)c2ccccc2F)ccc1OC(=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C28H21FN2O5/c1-35-25-16-18(15-19(17-30)20-7-4-5-10-23(20)29)12-13-24(25)36-26(32)11-6-14-31-27(33)21-8-2-3-9-22(21)28(31)34/h2-5,7-10,12-13,15-16H,6,11,14H2,1H3/b19-15- |
| InChIKey | MRJVDVWSNOJBGZ-CYVLTUHYSA-N |
| XLogP | 4.88 |
| TPSA | 96.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.48 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|