C31H24FNO3 — CID 39114181
[4-[(E)-2-cyano-2-(2-fluorophenyl)ethenyl]-2-methoxyphenyl] 3,3-diphenylpropanoate (PubChem CID 39114181) has the molecular formula C31H24FNO3 and a molecular weight of 477.54 g/mol. Its IUPAC name is [4-[(E)-2-cyano-2-(2-fluorophenyl)ethenyl]-2-methoxyphenyl] 3,3-diphenylpropanoate.
| Compound Name | [4-[(E)-2-cyano-2-(2-fluorophenyl)ethenyl]-2-methoxyphenyl] 3,3-diphenylpropanoate |
|---|---|
| PubChem CID | 39114181 |
| Molecular Formula | C31H24FNO3 |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | [4-[(E)-2-cyano-2-(2-fluorophenyl)ethenyl]-2-methoxyphenyl] 3,3-diphenylpropanoate |
| SMILES | COc1cc(/C=C(/C#N)c2ccccc2F)ccc1OC(=O)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H24FNO3/c1-35-30-19-22(18-25(21-33)26-14-8-9-15-28(26)32)16-17-29(30)36-31(34)20-27(23-10-4-2-5-11-23)24-12-6-3-7-13-24/h2-19,27H,20H2,1H3/b25-18- |
| InChIKey | KOJPNHJAKRQEEB-BWAHOGKJSA-N |
| XLogP | 7.03 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|