C25H17ClFNO3 — CID 39114230
[4-[(E)-2-cyano-2-(2-fluorophenyl)ethenyl]-2-methoxyphenyl] (E)-3-(4-chlorophenyl)prop-2-enoate (PubChem CID 39114230) has the molecular formula C25H17ClFNO3 and a molecular weight of 433.87 g/mol. Its IUPAC name is [4-[(E)-2-cyano-2-(2-fluorophenyl)ethenyl]-2-methoxyphenyl] (E)-3-(4-chlorophenyl)prop-2-enoate.
| Compound Name | [4-[(E)-2-cyano-2-(2-fluorophenyl)ethenyl]-2-methoxyphenyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 39114230 |
| Molecular Formula | C25H17ClFNO3 |
| Molecular Weight | 433.87 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | [4-[(E)-2-cyano-2-(2-fluorophenyl)ethenyl]-2-methoxyphenyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C(/C#N)c2ccccc2F)ccc1OC(=O)/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H17ClFNO3/c1-30-24-15-18(14-19(16-28)21-4-2-3-5-22(21)27)8-12-23(24)31-25(29)13-9-17-6-10-20(26)11-7-17/h2-15H,1H3/b13-9+,19-14- |
| InChIKey | WORNTXMMAHIHPV-VOVVEXOKSA-N |
| XLogP | 6.17 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.87 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|