C27H22ClNO5 — CID 4247745
[4-[2-(4-chlorophenyl)-2-cyanoethenyl]-2-methoxyphenyl] 3-(2,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 4247745) has the molecular formula C27H22ClNO5 and a molecular weight of 475.93 g/mol. Its IUPAC name is [4-[2-(4-chlorophenyl)-2-cyanoethenyl]-2-methoxyphenyl] 3-(2,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [4-[2-(4-chlorophenyl)-2-cyanoethenyl]-2-methoxyphenyl] 3-(2,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 4247745 |
| Molecular Formula | C27H22ClNO5 |
| Molecular Weight | 475.93 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | [4-[2-(4-chlorophenyl)-2-cyanoethenyl]-2-methoxyphenyl] 3-(2,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(C=CC(=O)Oc2ccc(C=C(C#N)c3ccc(Cl)cc3)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C27H22ClNO5/c1-31-23-11-7-20(25(16-23)32-2)8-13-27(30)34-24-12-4-18(15-26(24)33-3)14-21(17-29)19-5-9-22(28)10-6-19/h4-16H,1-3H3 |
| InChIKey | MCMJACROGWKPHT-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.93 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|