C29H24N2O6 — CID 39113749
[4-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] 4-(1,3-dioxoisoindol-2-yl)butanoate (PubChem CID 39113749) has the molecular formula C29H24N2O6 and a molecular weight of 496.52 g/mol. Its IUPAC name is [4-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] 4-(1,3-dioxoisoindol-2-yl)butanoate.
| Compound Name | [4-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] 4-(1,3-dioxoisoindol-2-yl)butanoate |
|---|---|
| PubChem CID | 39113749 |
| Molecular Formula | C29H24N2O6 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | [4-[(E)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]phenyl] 4-(1,3-dioxoisoindol-2-yl)butanoate |
| SMILES | COc1ccc(/C(C#N)=C\c2ccc(OC(=O)CCCN3C(=O)c4ccccc4C3=O)cc2)cc1OC |
| InChI | InChI=1S/C29H24N2O6/c1-35-25-14-11-20(17-26(25)36-2)21(18-30)16-19-9-12-22(13-10-19)37-27(32)8-5-15-31-28(33)23-6-3-4-7-24(23)29(31)34/h3-4,6-7,9-14,16-17H,5,8,15H2,1-2H3/b21-16- |
| InChIKey | GXDHTSPFLXHJOD-PGMHBOJBSA-N |
| XLogP | 4.75 |
| TPSA | 105.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|