C26H18N2O4 — CID 39112793
[4-[(E)-2-cyano-2-phenylethenyl]phenyl] 3-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 39112793) has the molecular formula C26H18N2O4 and a molecular weight of 422.44 g/mol. Its IUPAC name is [4-[(E)-2-cyano-2-phenylethenyl]phenyl] 3-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [4-[(E)-2-cyano-2-phenylethenyl]phenyl] 3-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 39112793 |
| Molecular Formula | C26H18N2O4 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | [4-[(E)-2-cyano-2-phenylethenyl]phenyl] 3-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | N#C/C(=C/c1ccc(OC(=O)CCN2C(=O)c3ccccc3C2=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H18N2O4/c27-17-20(19-6-2-1-3-7-19)16-18-10-12-21(13-11-18)32-24(29)14-15-28-25(30)22-8-4-5-9-23(22)26(28)31/h1-13,16H,14-15H2/b20-16- |
| InChIKey | YEKPRMNLQWAHJX-SILNSSARSA-N |
| XLogP | 4.34 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|