C22H16N2O6 — CID 19197240
methyl (E)-2-cyano-3-[3-[3-(1,3-dioxoisoindol-2-yl)propanoyloxy]phenyl]prop-2-enoate (PubChem CID 19197240) has the molecular formula C22H16N2O6 and a molecular weight of 404.38 g/mol. Its IUPAC name is methyl (E)-2-cyano-3-[3-[3-(1,3-dioxoisoindol-2-yl)propanoyloxy]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-2-cyano-3-[3-[3-(1,3-dioxoisoindol-2-yl)propanoyloxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 19197240 |
| Molecular Formula | C22H16N2O6 |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | methyl (E)-2-cyano-3-[3-[3-(1,3-dioxoisoindol-2-yl)propanoyloxy]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C(C#N)=C/c1cccc(OC(=O)CCN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C22H16N2O6/c1-29-22(28)15(13-23)11-14-5-4-6-16(12-14)30-19(25)9-10-24-20(26)17-7-2-3-8-18(17)21(24)27/h2-8,11-12H,9-10H2,1H3/b15-11+ |
| InChIKey | MJIJWLRHNNZHPC-RVDMUPIBSA-N |
| XLogP | 2.36 |
| TPSA | 113.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|