C16H17NO4 — CID 19204209
[3-[(E)-2-cyano-3-methoxy-3-oxoprop-1-enyl]phenyl] 3-methylbutanoate (PubChem CID 19204209) has the molecular formula C16H17NO4 and a molecular weight of 287.32 g/mol. Its IUPAC name is [3-[(E)-2-cyano-3-methoxy-3-oxoprop-1-enyl]phenyl] 3-methylbutanoate.
| Compound Name | [3-[(E)-2-cyano-3-methoxy-3-oxoprop-1-enyl]phenyl] 3-methylbutanoate |
|---|---|
| PubChem CID | 19204209 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | [3-[(E)-2-cyano-3-methoxy-3-oxoprop-1-enyl]phenyl] 3-methylbutanoate |
| SMILES | COC(=O)/C(C#N)=C/c1cccc(OC(=O)CC(C)C)c1 |
| InChI | InChI=1S/C16H17NO4/c1-11(2)7-15(18)21-14-6-4-5-12(9-14)8-13(10-17)16(19)20-3/h4-6,8-9,11H,7H2,1-3H3/b13-8+ |
| InChIKey | WUBKIGTZSNSSBI-MDWZMJQESA-N |
| XLogP | 2.72 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|