C22H19NO6 — CID 19195446
methyl (E)-2-cyano-3-[3-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]oxyphenyl]prop-2-enoate (PubChem CID 19195446) has the molecular formula C22H19NO6 and a molecular weight of 393.40 g/mol. Its IUPAC name is methyl (E)-2-cyano-3-[3-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]oxyphenyl]prop-2-enoate.
| Compound Name | methyl (E)-2-cyano-3-[3-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]oxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 19195446 |
| Molecular Formula | C22H19NO6 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | methyl (E)-2-cyano-3-[3-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]oxyphenyl]prop-2-enoate |
| SMILES | COC(=O)/C(C#N)=C/c1cccc(OC(=O)/C=C/c2ccc(OC)cc2OC)c1 |
| InChI | InChI=1S/C22H19NO6/c1-26-18-9-7-16(20(13-18)27-2)8-10-21(24)29-19-6-4-5-15(12-19)11-17(14-23)22(25)28-3/h4-13H,1-3H3/b10-8+,17-11+ |
| InChIKey | NSTRFUICAFMEGD-YBUNMWENSA-N |
| XLogP | 3.40 |
| TPSA | 94.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|