C19H20O4 — CID 732859
(3,4-dimethylphenyl) 3-(2,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 732859) has the molecular formula C19H20O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is (3,4-dimethylphenyl) 3-(2,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | (3,4-dimethylphenyl) 3-(2,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 732859 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | (3,4-dimethylphenyl) 3-(2,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(C=CC(=O)Oc2ccc(C)c(C)c2)c(OC)c1 |
| InChI | InChI=1S/C19H20O4/c1-13-5-8-17(11-14(13)2)23-19(20)10-7-15-6-9-16(21-3)12-18(15)22-4/h5-12H,1-4H3 |
| InChIKey | DSVRFKLJWKKQDG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|