C12H12O5 — CID 82159207
(E)-4-(2,4-dimethoxyphenyl)-2-oxobut-3-enoic acid (PubChem CID 82159207) has the molecular formula C12H12O5 and a molecular weight of 236.22 g/mol. Its IUPAC name is (E)-4-(2,4-dimethoxyphenyl)-2-oxobut-3-enoic acid.
| Compound Name | (E)-4-(2,4-dimethoxyphenyl)-2-oxobut-3-enoic acid |
|---|---|
| PubChem CID | 82159207 |
| Molecular Formula | C12H12O5 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | (E)-4-(2,4-dimethoxyphenyl)-2-oxobut-3-enoic acid |
| SMILES | COc1ccc(/C=C/C(=O)C(=O)O)c(OC)c1 |
| InChI | InChI=1S/C12H12O5/c1-16-9-5-3-8(11(7-9)17-2)4-6-10(13)12(14)15/h3-7H,1-2H3,(H,14,15)/b6-4+ |
| InChIKey | AYRCHFOPMQTKCZ-GQCTYLIASA-N |
| XLogP | 1.37 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|