C14H17NO5 — CID 82043566
2-[[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]propanoic acid (PubChem CID 82043566) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is 2-[[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]propanoic acid.
| Compound Name | 2-[[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 82043566 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 2-[[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]propanoic acid |
| SMILES | COc1ccc(/C=C/C(=O)NC(C)C(=O)O)c(OC)c1 |
| InChI | InChI=1S/C14H17NO5/c1-9(14(17)18)15-13(16)7-5-10-4-6-11(19-2)8-12(10)20-3/h4-9H,1-3H3,(H,15,16)(H,17,18)/b7-5+ |
| InChIKey | BYPIZOIQHDYXGG-FNORWQNLSA-N |
| XLogP | 1.31 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|