C17H24N2O4 — CID 78773077
2-[3-(2,4-dimethoxyphenyl)prop-2-enoylamino]-3-methylpentanamide (PubChem CID 78773077) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-[3-(2,4-dimethoxyphenyl)prop-2-enoylamino]-3-methylpentanamide.
| Compound Name | 2-[3-(2,4-dimethoxyphenyl)prop-2-enoylamino]-3-methylpentanamide |
|---|---|
| PubChem CID | 78773077 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 2-[3-(2,4-dimethoxyphenyl)prop-2-enoylamino]-3-methylpentanamide |
| SMILES | CCC(C)C(NC(=O)C=Cc1ccc(OC)cc1OC)C(N)=O |
| InChI | InChI=1S/C17H24N2O4/c1-5-11(2)16(17(18)21)19-15(20)9-7-12-6-8-13(22-3)10-14(12)23-4/h6-11,16H,5H2,1-4H3,(H2,18,21)(H,19,20) |
| InChIKey | OQLIUIZTZKNBHW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|