C15H19Cl2NO3 — CID 11012991
(E)-N,N-bis(2-chloroethyl)-3-(2,4-dimethoxyphenyl)prop-2-enamide (PubChem CID 11012991) has the molecular formula C15H19Cl2NO3 and a molecular weight of 332.23 g/mol. Its IUPAC name is (E)-N,N-bis(2-chloroethyl)-3-(2,4-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N,N-bis(2-chloroethyl)-3-(2,4-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 11012991 |
| Molecular Formula | C15H19Cl2NO3 |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | (E)-N,N-bis(2-chloroethyl)-3-(2,4-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)N(CCCl)CCCl)c(OC)c1 |
| InChI | InChI=1S/C15H19Cl2NO3/c1-20-13-5-3-12(14(11-13)21-2)4-6-15(19)18(9-7-16)10-8-17/h3-6,11H,7-10H2,1-2H3/b6-4+ |
| InChIKey | QNVWBKWNLGMXEA-GQCTYLIASA-N |
| XLogP | 3.02 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|