C20H21F2NO4 — CID 34984603
(E)-N-[[4-(difluoromethoxy)phenyl]methyl]-3-(2,4-dimethoxyphenyl)-N-methylprop-2-enamide (PubChem CID 34984603) has the molecular formula C20H21F2NO4 and a molecular weight of 377.39 g/mol. Its IUPAC name is (E)-N-[[4-(difluoromethoxy)phenyl]methyl]-3-(2,4-dimethoxyphenyl)-N-methylprop-2-enamide.
| Compound Name | (E)-N-[[4-(difluoromethoxy)phenyl]methyl]-3-(2,4-dimethoxyphenyl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 34984603 |
| Molecular Formula | C20H21F2NO4 |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | (E)-N-[[4-(difluoromethoxy)phenyl]methyl]-3-(2,4-dimethoxyphenyl)-N-methylprop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)N(C)Cc2ccc(OC(F)F)cc2)c(OC)c1 |
| InChI | InChI=1S/C20H21F2NO4/c1-23(13-14-4-8-16(9-5-14)27-20(21)22)19(24)11-7-15-6-10-17(25-2)12-18(15)26-3/h4-12,20H,13H2,1-3H3/b11-7+ |
| InChIKey | DCHQKCSSRQYEPA-YRNVUSSQSA-N |
| XLogP | 3.98 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|