C20H20F2N2O6 — CID 43049975
(E)-3-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]-N-[(3-methoxyphenyl)methyl]-N-methylprop-2-enamide (PubChem CID 43049975) has the molecular formula C20H20F2N2O6 and a molecular weight of 422.38 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]-N-[(3-methoxyphenyl)methyl]-N-methylprop-2-enamide.
| Compound Name | (E)-3-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]-N-[(3-methoxyphenyl)methyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 43049975 |
| Molecular Formula | C20H20F2N2O6 |
| Molecular Weight | 422.38 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]-N-[(3-methoxyphenyl)methyl]-N-methylprop-2-enamide |
| SMILES | COc1cccc(CN(C)C(=O)/C=C/c2cc(OC)c(OC(F)F)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H20F2N2O6/c1-23(12-13-5-4-6-15(9-13)28-2)19(25)8-7-14-10-17(29-3)18(30-20(21)22)11-16(14)24(26)27/h4-11,20H,12H2,1-3H3/b8-7+ |
| InChIKey | IOTUIULCALRHTC-BQYQJAHWSA-N |
| XLogP | 3.89 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|