C18H15F2NO7 — CID 24582970
(E)-3-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]-1-(4-hydroxy-3-methoxyphenyl)prop-2-en-1-one (PubChem CID 24582970) has the molecular formula C18H15F2NO7 and a molecular weight of 395.31 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]-1-(4-hydroxy-3-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]-1-(4-hydroxy-3-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 24582970 |
| Molecular Formula | C18H15F2NO7 |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]-1-(4-hydroxy-3-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(C(=O)/C=C/c2cc(OC)c(OC(F)F)cc2[N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C18H15F2NO7/c1-26-15-8-11(4-6-14(15)23)13(22)5-3-10-7-16(27-2)17(28-18(19)20)9-12(10)21(24)25/h3-9,18,23H,1-2H3/b5-3+ |
| InChIKey | JQMGWMWIYMTFNK-HWKANZROSA-N |
| XLogP | 3.82 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|