C20H19F2NO7 — CID 47046293
(E)-3-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]-1-[4-(2-methoxyethoxy)phenyl]prop-2-en-1-one (PubChem CID 47046293) has the molecular formula C20H19F2NO7 and a molecular weight of 423.37 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]-1-[4-(2-methoxyethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]-1-[4-(2-methoxyethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 47046293 |
| Molecular Formula | C20H19F2NO7 |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)-5-methoxy-2-nitrophenyl]-1-[4-(2-methoxyethoxy)phenyl]prop-2-en-1-one |
| SMILES | COCCOc1ccc(C(=O)/C=C/c2cc(OC)c(OC(F)F)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H19F2NO7/c1-27-9-10-29-15-6-3-13(4-7-15)17(24)8-5-14-11-18(28-2)19(30-20(21)22)12-16(14)23(25)26/h3-8,11-12,20H,9-10H2,1-2H3/b8-5+ |
| InChIKey | RPAZPWOQXJNJBW-VMPITWQZSA-N |
| XLogP | 4.13 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|